C20H31NO — CID 57286470
(1R,2S)-8-methoxy-1-prop-2-enyl-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 57286470) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is (1R,2S)-8-methoxy-1-prop-2-enyl-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | (1R,2S)-8-methoxy-1-prop-2-enyl-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 57286470 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | (1R,2S)-8-methoxy-1-prop-2-enyl-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | C=CC[C@@H]1c2c(cccc2OC)CC[C@@H]1N(CCC)CCC |
| InChI | InChI=1S/C20H31NO/c1-5-9-17-18(21(14-6-2)15-7-3)13-12-16-10-8-11-19(22-4)20(16)17/h5,8,10-11,17-18H,1,6-7,9,12-15H2,2-4H3/t17-,18-/m0/s1 |
| InChIKey | UHNVTKKSOVHIOE-ROUUACIJSA-N |
| XLogP | 4.79 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|