C14H18N2O4S2 — CID 57286896
sulfanyl (6R)-3-(2,4-dimethyl-2H-1,3-thiazol-3-yl)-6-[(1R)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 57286896) has the molecular formula C14H18N2O4S2 and a molecular weight of 342.44 g/mol. Its IUPAC name is sulfanyl (6R)-3-(2,4-dimethyl-2H-1,3-thiazol-3-yl)-6-[(1R)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | sulfanyl (6R)-3-(2,4-dimethyl-2H-1,3-thiazol-3-yl)-6-[(1R)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 57286896 |
| Molecular Formula | C14H18N2O4S2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | sulfanyl (6R)-3-(2,4-dimethyl-2H-1,3-thiazol-3-yl)-6-[(1R)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC1=CSC(C)N1C1=C(C(=O)OS)N2C(=O)[C@@H]([C@@H](C)O)C2C1 |
| InChI | InChI=1S/C14H18N2O4S2/c1-6-5-22-8(3)15(6)10-4-9-11(7(2)17)13(18)16(9)12(10)14(19)20-21/h5,7-9,11,17,21H,4H2,1-3H3/t7-,8?,9?,11+/m1/s1 |
| InChIKey | BKRVQDHXKUFQHA-BBRNTIAVSA-N |
| XLogP | 1.45 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|