C27H28N2O2S — CID 57287439
1-[3-[2-amino-3-(1,2,3,4,6,9,10,10a-octahydropyrido[1,2-a]azepin-8-yl)-1-benzothiophene-5-carbonyl]phenyl]ethanone (PubChem CID 57287439) has the molecular formula C27H28N2O2S and a molecular weight of 444.60 g/mol. Its IUPAC name is 1-[3-[2-amino-3-(1,2,3,4,6,9,10,10a-octahydropyrido[1,2-a]azepin-8-yl)-1-benzothiophene-5-carbonyl]phenyl]ethanone.
| Compound Name | 1-[3-[2-amino-3-(1,2,3,4,6,9,10,10a-octahydropyrido[1,2-a]azepin-8-yl)-1-benzothiophene-5-carbonyl]phenyl]ethanone |
|---|---|
| PubChem CID | 57287439 |
| Molecular Formula | C27H28N2O2S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 1-[3-[2-amino-3-(1,2,3,4,6,9,10,10a-octahydropyrido[1,2-a]azepin-8-yl)-1-benzothiophene-5-carbonyl]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(C(=O)c2ccc3sc(N)c(C4=CCN5CCCCC5CC4)c3c2)c1 |
| InChI | InChI=1S/C27H28N2O2S/c1-17(30)19-5-4-6-20(15-19)26(31)21-9-11-24-23(16-21)25(27(28)32-24)18-8-10-22-7-2-3-13-29(22)14-12-18/h4-6,9,11-12,15-16,22H,2-3,7-8,10,13-14,28H2,1H3 |
| InChIKey | UMZRBVSYUSEYLO-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |