C15H31NO — CID 57290446
2-tert-butyl-3,3-dimethyl-2-piperidin-1-ylbutan-1-ol (PubChem CID 57290446) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is 2-tert-butyl-3,3-dimethyl-2-piperidin-1-ylbutan-1-ol.
| Compound Name | 2-tert-butyl-3,3-dimethyl-2-piperidin-1-ylbutan-1-ol |
|---|---|
| PubChem CID | 57290446 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | 2-tert-butyl-3,3-dimethyl-2-piperidin-1-ylbutan-1-ol |
| SMILES | CC(C)(C)C(CO)(N1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C15H31NO/c1-13(2,3)15(12-17,14(4,5)6)16-10-8-7-9-11-16/h17H,7-12H2,1-6H3 |
| InChIKey | AUFLSZDHEQIGIS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |