C6H7N2O2S- — CID 57291040
2,5-diaminobenzenesulfinate (PubChem CID 57291040) has the molecular formula C6H7N2O2S- and a molecular weight of 171.20 g/mol. Its IUPAC name is 2,5-diaminobenzenesulfinate.
| Compound Name | 2,5-diaminobenzenesulfinate |
|---|---|
| PubChem CID | 57291040 |
| Molecular Formula | C6H7N2O2S- |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.02 |
| IUPAC Name | 2,5-diaminobenzenesulfinate |
| SMILES | Nc1ccc(N)c(S(=O)[O-])c1 |
| InChI | InChI=1S/C6H8N2O2S/c7-4-1-2-5(8)6(3-4)11(9)10/h1-3H,7-8H2,(H,9,10)/p-1 |
| InChIKey | BCFVJRDQWLJNJS-UHFFFAOYSA-M |
| XLogP | 0.09 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|