C27H31F2NO3S — CID 57291933
O-[3,3-bis(4-fluorophenyl)propyl] (2S)-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carbothioate (PubChem CID 57291933) has the molecular formula C27H31F2NO3S and a molecular weight of 487.61 g/mol. Its IUPAC name is O-[3,3-bis(4-fluorophenyl)propyl] (2S)-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carbothioate.
| Compound Name | O-[3,3-bis(4-fluorophenyl)propyl] (2S)-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carbothioate |
|---|---|
| PubChem CID | 57291933 |
| Molecular Formula | C27H31F2NO3S |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | O-[3,3-bis(4-fluorophenyl)propyl] (2S)-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carbothioate |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCC[C@H]1C(=S)OCCC(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H31F2NO3S/c1-4-27(2,3)24(31)25(32)30-16-5-6-23(30)26(34)33-17-15-22(18-7-11-20(28)12-8-18)19-9-13-21(29)14-10-19/h7-14,22-23H,4-6,15-17H2,1-3H3/t23-/m0/s1 |
| InChIKey | QZQUTWDQCFCMKU-QHCPKHFHSA-N |
| XLogP | 5.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|