C21H32N2O4 — CID 57294482
(3,8,8,9,10,10-hexamethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methyl pyridine-3-carboxylate (PubChem CID 57294482) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is (3,8,8,9,10,10-hexamethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methyl pyridine-3-carboxylate.
| Compound Name | (3,8,8,9,10,10-hexamethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methyl pyridine-3-carboxylate |
|---|---|
| PubChem CID | 57294482 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | (3,8,8,9,10,10-hexamethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methyl pyridine-3-carboxylate |
| SMILES | CN1C(C)(C)CC2(CC1(C)C)OCC(C)(COC(=O)c1cccnc1)CO2 |
| InChI | InChI=1S/C21H32N2O4/c1-18(2)11-21(12-19(3,4)23(18)6)26-14-20(5,15-27-21)13-25-17(24)16-8-7-9-22-10-16/h7-10H,11-15H2,1-6H3 |
| InChIKey | UAZAJRCCTJUKTD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |