C17H17NS — CID 57296921
3-ethyl-5-phenyl-2,3-dihydro-1,4-benzothiazepine (PubChem CID 57296921) has the molecular formula C17H17NS and a molecular weight of 267.40 g/mol. Its IUPAC name is 3-ethyl-5-phenyl-2,3-dihydro-1,4-benzothiazepine.
| Compound Name | 3-ethyl-5-phenyl-2,3-dihydro-1,4-benzothiazepine |
|---|---|
| PubChem CID | 57296921 |
| Molecular Formula | C17H17NS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 3-ethyl-5-phenyl-2,3-dihydro-1,4-benzothiazepine |
| SMILES | CCC1CSc2ccccc2C(c2ccccc2)=N1 |
| InChI | InChI=1S/C17H17NS/c1-2-14-12-19-16-11-7-6-10-15(16)17(18-14)13-8-4-3-5-9-13/h3-11,14H,2,12H2,1H3 |
| InChIKey | SRNHXNJKQAIXFX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |