C27H45N — CID 57297449
(1R,2S,6S,9S,10R,11S,14S,15S,23S,24S)-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosane (PubChem CID 57297449) has the molecular formula C27H45N and a molecular weight of 383.66 g/mol. Its IUPAC name is (1R,2S,6S,9S,10R,11S,14S,15S,23S,24S)-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosane.
| Compound Name | (1R,2S,6S,9S,10R,11S,14S,15S,23S,24S)-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosane |
|---|---|
| PubChem CID | 57297449 |
| Molecular Formula | C27H45N |
| Molecular Weight | 383.66 g/mol |
| Exact Mass | 383.36 |
| IUPAC Name | (1R,2S,6S,9S,10R,11S,14S,15S,23S,24S)-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosane |
| SMILES | C[C@H]1CC[C@H]2[C@H](C)[C@H]3CC[C@@H]4[C@@H](C[C@H]5[C@H]4CCC4CCCC[C@@]45C)[C@@H]3CN2C1 |
| InChI | InChI=1S/C27H45N/c1-17-7-12-26-18(2)20-10-11-21-22-9-8-19-6-4-5-13-27(19,3)25(22)14-23(21)24(20)16-28(26)15-17/h17-26H,4-16H2,1-3H3/t17-,18+,19?,20+,21-,22-,23+,24+,25-,26-,27-/m0/s1 |
| InChIKey | GRTNBDIOACKBEA-SBGCFCCXSA-N |
| XLogP | 6.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.66 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |