C9H8Cl3N3O2 — CID 57297504
methyl 3-[4-methyl-6-(trichloromethyl)-1,3,5-triazin-2-yl]prop-2-enoate (PubChem CID 57297504) has the molecular formula C9H8Cl3N3O2 and a molecular weight of 296.54 g/mol. Its IUPAC name is methyl 3-[4-methyl-6-(trichloromethyl)-1,3,5-triazin-2-yl]prop-2-enoate.
| Compound Name | methyl 3-[4-methyl-6-(trichloromethyl)-1,3,5-triazin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 57297504 |
| Molecular Formula | C9H8Cl3N3O2 |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 294.97 |
| IUPAC Name | methyl 3-[4-methyl-6-(trichloromethyl)-1,3,5-triazin-2-yl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1nc(C)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C9H8Cl3N3O2/c1-5-13-6(3-4-7(16)17-2)15-8(14-5)9(10,11)12/h3-4H,1-2H3 |
| InChIKey | WKUTZLGNSRNQKD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|