C6H6ClN3O2 — CID 71964782
methyl 3-(5-chloro-1H-1,2,4-triazol-3-yl)prop-2-enoate (PubChem CID 71964782) has the molecular formula C6H6ClN3O2 and a molecular weight of 187.59 g/mol. Its IUPAC name is methyl 3-(5-chloro-1H-1,2,4-triazol-3-yl)prop-2-enoate.
| Compound Name | methyl 3-(5-chloro-1H-1,2,4-triazol-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 71964782 |
| Molecular Formula | C6H6ClN3O2 |
| Molecular Weight | 187.59 g/mol |
| Exact Mass | 187.01 |
| IUPAC Name | methyl 3-(5-chloro-1H-1,2,4-triazol-3-yl)prop-2-enoate |
| SMILES | COC(=O)C=Cc1n[nH]c(Cl)n1 |
| InChI | InChI=1S/C6H6ClN3O2/c1-12-5(11)3-2-4-8-6(7)10-9-4/h2-3H,1H3,(H,8,9,10) |
| InChIKey | ITDXJJYTVKMMEJ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.59 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|