C17H17BrO5S — CID 572985
ethyl 2-[2-(bromomethyl)-4-methoxy-6-oxopyran-3-yl]-2-phenylsulfanylacetate (PubChem CID 572985) has the molecular formula C17H17BrO5S and a molecular weight of 413.29 g/mol. Its IUPAC name is ethyl 2-[2-(bromomethyl)-4-methoxy-6-oxopyran-3-yl]-2-phenylsulfanylacetate.
| Compound Name | ethyl 2-[2-(bromomethyl)-4-methoxy-6-oxopyran-3-yl]-2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 572985 |
| Molecular Formula | C17H17BrO5S |
| Molecular Weight | 413.29 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | ethyl 2-[2-(bromomethyl)-4-methoxy-6-oxopyran-3-yl]-2-phenylsulfanylacetate |
| SMILES | CCOC(=O)C(Sc1ccccc1)c1c(OC)cc(=O)oc1CBr |
| InChI | InChI=1S/C17H17BrO5S/c1-3-22-17(20)16(24-11-7-5-4-6-8-11)15-12(21-2)9-14(19)23-13(15)10-18/h4-9,16H,3,10H2,1-2H3 |
| InChIKey | PYPSICCTAZARHO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.29 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|