About 3-iminohexan-1-ol
3-iminohexan-1-ol (PubChem CID 57298949) has the molecular formula C6H13NO
and a molecular weight of 115.18 g/mol. Its IUPAC name is 3-iminohexan-1-ol.
Molecular Properties
| Compound Name | 3-iminohexan-1-ol |
| PubChem CID | 57298949 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | 3-iminohexan-1-ol |
| SMILES | [H]/N=C(\CCC)CCO |
| InChI | InChI=1S/C6H13NO/c1-2-3-6(7)4-5-8/h7-8H,2-5H2,1H3/b7-6+ |
| InChIKey | PACRBQKNWDUUMM-VOTSOKGWSA-N |
| XLogP | 1.19 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-iminohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iminohexan-1-ol?
The IUPAC name of 3-iminohexan-1-ol (CID 57298949) is 3-iminohexan-1-ol.
What is the SMILES notation for 3-iminohexan-1-ol?
The canonical SMILES for 3-iminohexan-1-ol is [H]/N=C(\CCC)CCO.
What is the InChIKey of 3-iminohexan-1-ol?
The InChIKey is PACRBQKNWDUUMM-VOTSOKGWSA-N. The full InChI is InChI=1S/C6H13NO/c1-2-3-6(7)4-5-8/h7-8H,2-5H2,1H3/b7-6+.
What are the key properties of 3-iminohexan-1-ol?
3-iminohexan-1-ol has a molecular weight of 115.18 g/mol, XLogP of 1.19, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iminohexan-1-ol is sourced from PubChem (CID 57298949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).