C12H16O — CID 57300513
2-[(4-ethylphenyl)methyl]-3-methyloxirane (PubChem CID 57300513) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-[(4-ethylphenyl)methyl]-3-methyloxirane.
| Compound Name | 2-[(4-ethylphenyl)methyl]-3-methyloxirane |
|---|---|
| PubChem CID | 57300513 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 2-[(4-ethylphenyl)methyl]-3-methyloxirane |
| SMILES | CCc1ccc(CC2OC2C)cc1 |
| InChI | InChI=1S/C12H16O/c1-3-10-4-6-11(7-5-10)8-12-9(2)13-12/h4-7,9,12H,3,8H2,1-2H3 |
| InChIKey | YCLYVDVMDYNLQL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|