C22H22NO3S- — CID 57301065
1-[2-[3-(hydroxymethyl)phenyl]-3-phenylpropyl]-3-(sulfinatoamino)benzene (PubChem CID 57301065) has the molecular formula C22H22NO3S- and a molecular weight of 380.49 g/mol. Its IUPAC name is 1-[2-[3-(hydroxymethyl)phenyl]-3-phenylpropyl]-3-(sulfinatoamino)benzene.
| Compound Name | 1-[2-[3-(hydroxymethyl)phenyl]-3-phenylpropyl]-3-(sulfinatoamino)benzene |
|---|---|
| PubChem CID | 57301065 |
| Molecular Formula | C22H22NO3S- |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 1-[2-[3-(hydroxymethyl)phenyl]-3-phenylpropyl]-3-(sulfinatoamino)benzene |
| SMILES | O=S([O-])Nc1cccc(CC(Cc2ccccc2)c2cccc(CO)c2)c1 |
| InChI | InChI=1S/C22H23NO3S/c24-16-19-9-4-10-20(14-19)21(12-17-6-2-1-3-7-17)13-18-8-5-11-22(15-18)23-27(25)26/h1-11,14-15,21,23-24H,12-13,16H2,(H,25,26)/p-1 |
| InChIKey | WKZMXTHQBMENJL-UHFFFAOYSA-M |
| XLogP | 3.95 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|