C23H21FNO3S- — CID 57085876
1-acetyl-3-[2-(4-fluorophenyl)-3-[3-(sulfinatoamino)phenyl]propyl]benzene (PubChem CID 57085876) has the molecular formula C23H21FNO3S- and a molecular weight of 410.49 g/mol. Its IUPAC name is 1-acetyl-3-[2-(4-fluorophenyl)-3-[3-(sulfinatoamino)phenyl]propyl]benzene.
| Compound Name | 1-acetyl-3-[2-(4-fluorophenyl)-3-[3-(sulfinatoamino)phenyl]propyl]benzene |
|---|---|
| PubChem CID | 57085876 |
| Molecular Formula | C23H21FNO3S- |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 1-acetyl-3-[2-(4-fluorophenyl)-3-[3-(sulfinatoamino)phenyl]propyl]benzene |
| SMILES | CC(=O)c1cccc(CC(Cc2cccc(NS(=O)[O-])c2)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H22FNO3S/c1-16(26)20-6-2-4-17(12-20)13-21(19-8-10-22(24)11-9-19)14-18-5-3-7-23(15-18)25-29(27)28/h2-12,15,21,25H,13-14H2,1H3,(H,27,28)/p-1 |
| InChIKey | MZYXNOPQNLAPPO-UHFFFAOYSA-M |
| XLogP | 4.80 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|