About ethanamine;(sulfinatoamino)benzene
ethanamine;(sulfinatoamino)benzene (PubChem CID 68776959) has the molecular formula C8H13N2O2S-
and a molecular weight of 201.27 g/mol. Its IUPAC name is ethanamine;(sulfinatoamino)benzene.
Molecular Properties
| Compound Name | ethanamine;(sulfinatoamino)benzene |
| PubChem CID | 68776959 |
| Molecular Formula | C8H13N2O2S- |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | ethanamine;(sulfinatoamino)benzene |
| SMILES | CCN.O=S([O-])Nc1ccccc1 |
| InChI | InChI=1S/C6H7NO2S.C2H7N/c8-10(9)7-6-4-2-1-3-5-6;1-2-3/h1-5,7H,(H,8,9);2-3H2,1H3/p-1 |
| InChIKey | QBQPXUCCQCXSSK-UHFFFAOYSA-M |
| XLogP | 0.86 |
| TPSA | 78.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze ethanamine;(sulfinatoamino)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;(sulfinatoamino)benzene?
The IUPAC name of ethanamine;(sulfinatoamino)benzene (CID 68776959) is ethanamine;(sulfinatoamino)benzene.
What is the SMILES notation for ethanamine;(sulfinatoamino)benzene?
The canonical SMILES for ethanamine;(sulfinatoamino)benzene is CCN.O=S([O-])Nc1ccccc1.
What is the InChIKey of ethanamine;(sulfinatoamino)benzene?
The InChIKey is QBQPXUCCQCXSSK-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H7NO2S.C2H7N/c8-10(9)7-6-4-2-1-3-5-6;1-2-3/h1-5,7H,(H,8,9);2-3H2,1H3/p-1.
What are the key properties of ethanamine;(sulfinatoamino)benzene?
ethanamine;(sulfinatoamino)benzene has a molecular weight of 201.27 g/mol, XLogP of 0.86, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;(sulfinatoamino)benzene is sourced from PubChem (CID 68776959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).