C23H19N2O3S- — CID 123331490
3-ethyl-1-oxo-2-phenyl-8-[3-(sulfinatoamino)phenyl]isoquinoline (PubChem CID 123331490) has the molecular formula C23H19N2O3S- and a molecular weight of 403.48 g/mol. Its IUPAC name is 3-ethyl-1-oxo-2-phenyl-8-[3-(sulfinatoamino)phenyl]isoquinoline.
| Compound Name | 3-ethyl-1-oxo-2-phenyl-8-[3-(sulfinatoamino)phenyl]isoquinoline |
|---|---|
| PubChem CID | 123331490 |
| Molecular Formula | C23H19N2O3S- |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 3-ethyl-1-oxo-2-phenyl-8-[3-(sulfinatoamino)phenyl]isoquinoline |
| SMILES | CCc1cc2cccc(-c3cccc(NS(=O)[O-])c3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C23H20N2O3S/c1-2-19-15-17-9-7-13-21(16-8-6-10-18(14-16)24-29(27)28)22(17)23(26)25(19)20-11-4-3-5-12-20/h3-15,24H,2H2,1H3,(H,27,28)/p-1 |
| InChIKey | IUPAIYNTEVQAEP-UHFFFAOYSA-M |
| XLogP | 4.43 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|