C27H26N2O3 — CID 144543781
3-ethyl-8-[1-(oxan-4-yl)-6-oxo-3-pyridinyl]-2-phenylisoquinolin-1-one (PubChem CID 144543781) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is 3-ethyl-8-[1-(oxan-4-yl)-6-oxo-3-pyridinyl]-2-phenylisoquinolin-1-one.
| Compound Name | 3-ethyl-8-[1-(oxan-4-yl)-6-oxo-3-pyridinyl]-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 144543781 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 3-ethyl-8-[1-(oxan-4-yl)-6-oxo-3-pyridinyl]-2-phenylisoquinolin-1-one |
| SMILES | CCc1cc2cccc(-c3ccc(=O)n(C4CCOCC4)c3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C27H26N2O3/c1-2-21-17-19-7-6-10-24(26(19)27(31)29(21)23-8-4-3-5-9-23)20-11-12-25(30)28(18-20)22-13-15-32-16-14-22/h3-12,17-18,22H,2,13-16H2,1H3 |
| InChIKey | HFJFIJCCXSWWFG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |