C24H22N2O — CID 144514912
8-[3-(aminomethyl)phenyl]-3-ethyl-2-phenylisoquinolin-1-one (PubChem CID 144514912) has the molecular formula C24H22N2O and a molecular weight of 354.45 g/mol. Its IUPAC name is 8-[3-(aminomethyl)phenyl]-3-ethyl-2-phenylisoquinolin-1-one.
| Compound Name | 8-[3-(aminomethyl)phenyl]-3-ethyl-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 144514912 |
| Molecular Formula | C24H22N2O |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 8-[3-(aminomethyl)phenyl]-3-ethyl-2-phenylisoquinolin-1-one |
| SMILES | CCc1cc2cccc(-c3cccc(CN)c3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C24H22N2O/c1-2-20-15-19-10-7-13-22(18-9-6-8-17(14-18)16-25)23(19)24(27)26(20)21-11-4-3-5-12-21/h3-15H,2,16,25H2,1H3 |
| InChIKey | HAJXJOMWWBWIKQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |