C28H31N5O3 — CID 57301966
3-(1-cyclopropyl-1,2,3,4-tetrahydroisoquinolin-3-yl)-1-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]prop-2-en-1-one (PubChem CID 57301966) has the molecular formula C28H31N5O3 and a molecular weight of 485.59 g/mol. Its IUPAC name is 3-(1-cyclopropyl-1,2,3,4-tetrahydroisoquinolin-3-yl)-1-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]prop-2-en-1-one.
| Compound Name | 3-(1-cyclopropyl-1,2,3,4-tetrahydroisoquinolin-3-yl)-1-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 57301966 |
| Molecular Formula | C28H31N5O3 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | 3-(1-cyclopropyl-1,2,3,4-tetrahydroisoquinolin-3-yl)-1-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]prop-2-en-1-one |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(C(=O)C=CC2Cc3ccccc3C(C3CC3)N2)c1OC |
| InChI | InChI=1S/C28H31N5O3/c1-35-24-13-16(11-19-15-31-28(30)33-27(19)29)12-22(26(24)36-2)23(34)10-9-20-14-18-5-3-4-6-21(18)25(32-20)17-7-8-17/h3-6,9-10,12-13,15,17,20,25,32H,7-8,11,14H2,1-2H3,(H4,29,30,31,33) |
| InChIKey | POGOVGUDBDRUOY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|