C34H34N8O3 — CID 54423011
1-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]-3-[1-[4-(1,2,4-triazol-1-ylmethyl)phenyl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one (PubChem CID 54423011) has the molecular formula C34H34N8O3 and a molecular weight of 602.70 g/mol. Its IUPAC name is 1-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]-3-[1-[4-(1,2,4-triazol-1-ylmethyl)phenyl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one.
| Compound Name | 1-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]-3-[1-[4-(1,2,4-triazol-1-ylmethyl)phenyl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 54423011 |
| Molecular Formula | C34H34N8O3 |
| Molecular Weight | 602.70 g/mol |
| Exact Mass | 602.28 |
| IUPAC Name | 1-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]-3-[1-[4-(1,2,4-triazol-1-ylmethyl)phenyl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(C(=O)C=CN2CCc3ccccc3C2c2ccc(Cn3cncn3)cc2)c1OC |
| InChI | InChI=1S/C34H34N8O3/c1-44-30-17-23(15-26-18-38-34(36)40-33(26)35)16-28(32(30)45-2)29(43)12-14-41-13-11-24-5-3-4-6-27(24)31(41)25-9-7-22(8-10-25)19-42-21-37-20-39-42/h3-10,12,14,16-18,20-21,31H,11,13,15,19H2,1-2H3,(H4,35,36,38,40) |
| InChIKey | WCCOMPAXMRUGSI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 147.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.70 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|