C33H36N6O5 — CID 67605598
1-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]-5,6-dihydroxy-1-(1-pyridin-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)hex-1-en-3-one (PubChem CID 67605598) has the molecular formula C33H36N6O5 and a molecular weight of 596.69 g/mol. Its IUPAC name is 1-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]-5,6-dihydroxy-1-(1-pyridin-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)hex-1-en-3-one.
| Compound Name | 1-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]-5,6-dihydroxy-1-(1-pyridin-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)hex-1-en-3-one |
|---|---|
| PubChem CID | 67605598 |
| Molecular Formula | C33H36N6O5 |
| Molecular Weight | 596.69 g/mol |
| Exact Mass | 596.27 |
| IUPAC Name | 1-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]-5,6-dihydroxy-1-(1-pyridin-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)hex-1-en-3-one |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(C(=CC(=O)CC(O)CO)N2CCc3ccccc3C2c2ccccn2)c1OC |
| InChI | InChI=1S/C33H36N6O5/c1-43-29-15-20(13-22-18-37-33(35)38-32(22)34)14-26(31(29)44-2)28(17-23(41)16-24(42)19-40)39-12-10-21-7-3-4-8-25(21)30(39)27-9-5-6-11-36-27/h3-9,11,14-15,17-18,24,30,40,42H,10,12-13,16,19H2,1-2H3,(H4,34,35,37,38) |
| InChIKey | JFVQCLYMKJKHKC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 169.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.69 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|