C30H28N6O3 — CID 70266244
(E)-1-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]-3-[(1S)-1-phenyl-1H-phthalazin-2-yl]prop-2-en-1-one (PubChem CID 70266244) has the molecular formula C30H28N6O3 and a molecular weight of 520.59 g/mol. Its IUPAC name is (E)-1-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]-3-[(1S)-1-phenyl-1H-phthalazin-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]-3-[(1S)-1-phenyl-1H-phthalazin-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 70266244 |
| Molecular Formula | C30H28N6O3 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | (E)-1-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]-3-[(1S)-1-phenyl-1H-phthalazin-2-yl]prop-2-en-1-one |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(C(=O)/C=C/N2N=Cc3ccccc3[C@@H]2c2ccccc2)c1OC |
| InChI | InChI=1S/C30H28N6O3/c1-38-26-16-19(14-22-17-33-30(32)35-29(22)31)15-24(28(26)39-2)25(37)12-13-36-27(20-8-4-3-5-9-20)23-11-7-6-10-21(23)18-34-36/h3-13,15-18,27H,14H2,1-2H3,(H4,31,32,33,35)/b13-12+/t27-/m0/s1 |
| InChIKey | GRLAYXDIMYEYAE-QSRYBZNWSA-N |
| XLogP | 4.38 |
| TPSA | 128.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|