C31H30N6O7S — CID 54291052
[4-[2-[3-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]prop-2-enoyl]-1H-phthalazin-1-yl]phenyl]methyl hydrogen sulfate (PubChem CID 54291052) has the molecular formula C31H30N6O7S and a molecular weight of 630.68 g/mol. Its IUPAC name is [4-[2-[3-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]prop-2-enoyl]-1H-phthalazin-1-yl]phenyl]methyl hydrogen sulfate.
| Compound Name | [4-[2-[3-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]prop-2-enoyl]-1H-phthalazin-1-yl]phenyl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 54291052 |
| Molecular Formula | C31H30N6O7S |
| Molecular Weight | 630.68 g/mol |
| Exact Mass | 630.19 |
| IUPAC Name | [4-[2-[3-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]prop-2-enoyl]-1H-phthalazin-1-yl]phenyl]methyl hydrogen sulfate |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(C=CC(=O)N2N=Cc3ccccc3C2c2ccc(COS(=O)(=O)O)cc2)c1OC |
| InChI | InChI=1S/C31H30N6O7S/c1-42-26-15-20(14-24-16-34-31(33)36-30(24)32)13-22(29(26)43-2)11-12-27(38)37-28(25-6-4-3-5-23(25)17-35-37)21-9-7-19(8-10-21)18-44-45(39,40)41/h3-13,15-17,28H,14,18H2,1-2H3,(H,39,40,41)(H4,32,33,34,36) |
| InChIKey | RXNSGQXLIAXNNE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 192.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.68 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|