C34H34N6O5 — CID 118724625
[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2-methoxy-3-[(E)-3-oxo-3-(1-propyl-1H-phthalazin-2-yl)prop-1-enyl]phenyl] 4-methoxybenzoate (PubChem CID 118724625) has the molecular formula C34H34N6O5 and a molecular weight of 606.68 g/mol. Its IUPAC name is [5-[(2,4-diaminopyrimidin-5-yl)methyl]-2-methoxy-3-[(E)-3-oxo-3-(1-propyl-1H-phthalazin-2-yl)prop-1-enyl]phenyl] 4-methoxybenzoate.
| Compound Name | [5-[(2,4-diaminopyrimidin-5-yl)methyl]-2-methoxy-3-[(E)-3-oxo-3-(1-propyl-1H-phthalazin-2-yl)prop-1-enyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 118724625 |
| Molecular Formula | C34H34N6O5 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.26 |
| IUPAC Name | [5-[(2,4-diaminopyrimidin-5-yl)methyl]-2-methoxy-3-[(E)-3-oxo-3-(1-propyl-1H-phthalazin-2-yl)prop-1-enyl]phenyl] 4-methoxybenzoate |
| SMILES | CCCC1c2ccccc2C=NN1C(=O)/C=C/c1cc(Cc2cnc(N)nc2N)cc(OC(=O)c2ccc(OC)cc2)c1OC |
| InChI | InChI=1S/C34H34N6O5/c1-4-7-28-27-9-6-5-8-24(27)20-38-40(28)30(41)15-12-23-16-21(17-25-19-37-34(36)39-32(25)35)18-29(31(23)44-3)45-33(42)22-10-13-26(43-2)14-11-22/h5-6,8-16,18-20,28H,4,7,17H2,1-3H3,(H4,35,36,37,39)/b15-12+ |
| InChIKey | NCKWJNKEMKUFSN-NTCAYCPXSA-N |
| XLogP | 5.20 |
| TPSA | 155.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|