C32H32N6O5 — CID 45272221
(E)-3-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2-(dimethoxymethyl)-3-methoxyphenyl]-1-[1-(4-hydroxyphenyl)-1H-phthalazin-2-yl]prop-2-en-1-one (PubChem CID 45272221) has the molecular formula C32H32N6O5 and a molecular weight of 580.65 g/mol. Its IUPAC name is (E)-3-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2-(dimethoxymethyl)-3-methoxyphenyl]-1-[1-(4-hydroxyphenyl)-1H-phthalazin-2-yl]prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2-(dimethoxymethyl)-3-methoxyphenyl]-1-[1-(4-hydroxyphenyl)-1H-phthalazin-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 45272221 |
| Molecular Formula | C32H32N6O5 |
| Molecular Weight | 580.65 g/mol |
| Exact Mass | 580.24 |
| IUPAC Name | (E)-3-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2-(dimethoxymethyl)-3-methoxyphenyl]-1-[1-(4-hydroxyphenyl)-1H-phthalazin-2-yl]prop-2-en-1-one |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(/C=C/C(=O)N2N=Cc3ccccc3C2c2ccc(O)cc2)c1C(OC)OC |
| InChI | InChI=1S/C32H32N6O5/c1-41-26-16-19(15-23-17-35-32(34)37-30(23)33)14-21(28(26)31(42-2)43-3)10-13-27(40)38-29(20-8-11-24(39)12-9-20)25-7-5-4-6-22(25)18-36-38/h4-14,16-18,29,31,39H,15H2,1-3H3,(H4,33,34,35,37)/b13-10+ |
| InChIKey | AHKNEUOMCVNXIT-JLHYYAGUSA-N |
| XLogP | 4.22 |
| TPSA | 158.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.65 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|