C29H29N7O3 — CID 54552176
5-[2-[3-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]prop-2-enoyl]-1H-phthalazin-1-yl]pent-2-enenitrile (PubChem CID 54552176) has the molecular formula C29H29N7O3 and a molecular weight of 523.60 g/mol. Its IUPAC name is 5-[2-[3-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]prop-2-enoyl]-1H-phthalazin-1-yl]pent-2-enenitrile.
| Compound Name | 5-[2-[3-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]prop-2-enoyl]-1H-phthalazin-1-yl]pent-2-enenitrile |
|---|---|
| PubChem CID | 54552176 |
| Molecular Formula | C29H29N7O3 |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | 5-[2-[3-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]prop-2-enoyl]-1H-phthalazin-1-yl]pent-2-enenitrile |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(C=CC(=O)N2N=Cc3ccccc3C2CCC=CC#N)c1OC |
| InChI | InChI=1S/C29H29N7O3/c1-38-25-16-19(15-22-17-33-29(32)35-28(22)31)14-20(27(25)39-2)11-12-26(37)36-24(10-4-3-7-13-30)23-9-6-5-8-21(23)18-34-36/h3,5-9,11-12,14,16-18,24H,4,10,15H2,1-2H3,(H4,31,32,33,35) |
| InChIKey | ZKQUZABJPJFXKJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 152.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|