C20H20N4O5 — CID 67667349
2-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]-3-(furan-2-yl)prop-2-enoic acid (PubChem CID 67667349) has the molecular formula C20H20N4O5 and a molecular weight of 396.40 g/mol. Its IUPAC name is 2-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]-3-(furan-2-yl)prop-2-enoic acid.
| Compound Name | 2-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]-3-(furan-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 67667349 |
| Molecular Formula | C20H20N4O5 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 2-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]-3-(furan-2-yl)prop-2-enoic acid |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(C(=Cc2ccco2)C(=O)O)c1OC |
| InChI | InChI=1S/C20H20N4O5/c1-27-16-8-11(6-12-10-23-20(22)24-18(12)21)7-14(17(16)28-2)15(19(25)26)9-13-4-3-5-29-13/h3-5,7-10H,6H2,1-2H3,(H,25,26)(H4,21,22,23,24) |
| InChIKey | QCKNCCREQISGRF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 146.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|