C24H32N2O6 — CID 57302863
2-[2-aminoethyl-[1-carboxy-2-(2-phenylethoxy)ethyl]amino]-3-(2-phenylethoxy)propanoic acid (PubChem CID 57302863) has the molecular formula C24H32N2O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is 2-[2-aminoethyl-[1-carboxy-2-(2-phenylethoxy)ethyl]amino]-3-(2-phenylethoxy)propanoic acid.
| Compound Name | 2-[2-aminoethyl-[1-carboxy-2-(2-phenylethoxy)ethyl]amino]-3-(2-phenylethoxy)propanoic acid |
|---|---|
| PubChem CID | 57302863 |
| Molecular Formula | C24H32N2O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 2-[2-aminoethyl-[1-carboxy-2-(2-phenylethoxy)ethyl]amino]-3-(2-phenylethoxy)propanoic acid |
| SMILES | NCCN(C(COCCc1ccccc1)C(=O)O)C(COCCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H32N2O6/c25-13-14-26(21(23(27)28)17-31-15-11-19-7-3-1-4-8-19)22(24(29)30)18-32-16-12-20-9-5-2-6-10-20/h1-10,21-22H,11-18,25H2,(H,27,28)(H,29,30) |
| InChIKey | PXESRGKBBYSXDQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|