About 2-(4-chloro-3-nitrophenyl)-4,6-dinitrobenzotriazole
2-(4-chloro-3-nitrophenyl)-4,6-dinitrobenzotriazole (PubChem CID 57307785) has the molecular formula C12H5ClN6O6
and a molecular weight of 364.66 g/mol. Its IUPAC name is 2-(4-chloro-3-nitrophenyl)-4,6-dinitrobenzotriazole.
Molecular Properties
| Compound Name | 2-(4-chloro-3-nitrophenyl)-4,6-dinitrobenzotriazole |
| PubChem CID | 57307785 |
| Molecular Formula | C12H5ClN6O6 |
| Molecular Weight | 364.66 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | 2-(4-chloro-3-nitrophenyl)-4,6-dinitrobenzotriazole |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c2nn(-c3ccc(Cl)c([N+](=O)[O-])c3)nc2c1 |
| InChI | InChI=1S/C12H5ClN6O6/c13-8-2-1-6(4-10(8)18(22)23)16-14-9-3-7(17(20)21)5-11(19(24)25)12(9)15-16/h1-5H |
| InChIKey | STEFZFRNDACJKB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 160.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.66 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chloro-3-nitrophenyl)-4,6-dinitrobenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-3-nitrophenyl)-4,6-dinitrobenzotriazole?
The IUPAC name of 2-(4-chloro-3-nitrophenyl)-4,6-dinitrobenzotriazole (CID 57307785) is 2-(4-chloro-3-nitrophenyl)-4,6-dinitrobenzotriazole.
What is the SMILES notation for 2-(4-chloro-3-nitrophenyl)-4,6-dinitrobenzotriazole?
The canonical SMILES for 2-(4-chloro-3-nitrophenyl)-4,6-dinitrobenzotriazole is O=[N+]([O-])c1cc([N+](=O)[O-])c2nn(-c3ccc(Cl)c([N+](=O)[O-])c3)nc2c1.
What is the InChIKey of 2-(4-chloro-3-nitrophenyl)-4,6-dinitrobenzotriazole?
The InChIKey is STEFZFRNDACJKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5ClN6O6/c13-8-2-1-6(4-10(8)18(22)23)16-14-9-3-7(17(20)21)5-11(19(24)25)12(9)15-16/h1-5H.
What are the key properties of 2-(4-chloro-3-nitrophenyl)-4,6-dinitrobenzotriazole?
2-(4-chloro-3-nitrophenyl)-4,6-dinitrobenzotriazole has a molecular weight of 364.66 g/mol, XLogP of 2.80, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-3-nitrophenyl)-4,6-dinitrobenzotriazole is sourced from PubChem (CID 57307785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).