About 2-(4-methylphenyl)-4,6-dinitroindazole
2-(4-methylphenyl)-4,6-dinitroindazole (PubChem CID 626844) has the molecular formula C14H10N4O4
and a molecular weight of 298.26 g/mol. Its IUPAC name is 2-(4-methylphenyl)-4,6-dinitroindazole.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)-4,6-dinitroindazole |
| PubChem CID | 626844 |
| Molecular Formula | C14H10N4O4 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-(4-methylphenyl)-4,6-dinitroindazole |
| SMILES | Cc1ccc(-n2cc3c([N+](=O)[O-])cc([N+](=O)[O-])cc3n2)cc1 |
| InChI | InChI=1S/C14H10N4O4/c1-9-2-4-10(5-3-9)16-8-12-13(15-16)6-11(17(19)20)7-14(12)18(21)22/h2-8H,1H3 |
| InChIKey | FUUDVFHHUBCDQB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 104.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methylphenyl)-4,6-dinitroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)-4,6-dinitroindazole?
The IUPAC name of 2-(4-methylphenyl)-4,6-dinitroindazole (CID 626844) is 2-(4-methylphenyl)-4,6-dinitroindazole.
What is the SMILES notation for 2-(4-methylphenyl)-4,6-dinitroindazole?
The canonical SMILES for 2-(4-methylphenyl)-4,6-dinitroindazole is Cc1ccc(-n2cc3c([N+](=O)[O-])cc([N+](=O)[O-])cc3n2)cc1.
What is the InChIKey of 2-(4-methylphenyl)-4,6-dinitroindazole?
The InChIKey is FUUDVFHHUBCDQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4O4/c1-9-2-4-10(5-3-9)16-8-12-13(15-16)6-11(17(19)20)7-14(12)18(21)22/h2-8H,1H3.
What are the key properties of 2-(4-methylphenyl)-4,6-dinitroindazole?
2-(4-methylphenyl)-4,6-dinitroindazole has a molecular weight of 298.26 g/mol, XLogP of 3.15, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)-4,6-dinitroindazole is sourced from PubChem (CID 626844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).