C17H26NO5P — CID 57311493
methyl 2-[methyl-[2-methyl-1-(phenylmethoxycarbonylamino)propyl]phosphanyl]oxypropanoate (PubChem CID 57311493) has the molecular formula C17H26NO5P and a molecular weight of 355.37 g/mol. Its IUPAC name is methyl 2-[methyl-[2-methyl-1-(phenylmethoxycarbonylamino)propyl]phosphanyl]oxypropanoate.
| Compound Name | methyl 2-[methyl-[2-methyl-1-(phenylmethoxycarbonylamino)propyl]phosphanyl]oxypropanoate |
|---|---|
| PubChem CID | 57311493 |
| Molecular Formula | C17H26NO5P |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | methyl 2-[methyl-[2-methyl-1-(phenylmethoxycarbonylamino)propyl]phosphanyl]oxypropanoate |
| SMILES | COC(=O)C(C)OP(C)C(NC(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C17H26NO5P/c1-12(2)15(24(5)23-13(3)16(19)21-4)18-17(20)22-11-14-9-7-6-8-10-14/h6-10,12-13,15H,11H2,1-5H3,(H,18,20) |
| InChIKey | NQOOSOWXUSDWNX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|