C24H29N7OS — CID 57311984
N-methyl-1-oxo-4-[2-[4-[propyl(pyridin-2-yl)amino]butyl]pyrrol-2-yl]-N-pyridin-4-yl-1,2,5-thiadiazol-3-amine (PubChem CID 57311984) has the molecular formula C24H29N7OS and a molecular weight of 463.61 g/mol. Its IUPAC name is N-methyl-1-oxo-4-[2-[4-[propyl(pyridin-2-yl)amino]butyl]pyrrol-2-yl]-N-pyridin-4-yl-1,2,5-thiadiazol-3-amine.
| Compound Name | N-methyl-1-oxo-4-[2-[4-[propyl(pyridin-2-yl)amino]butyl]pyrrol-2-yl]-N-pyridin-4-yl-1,2,5-thiadiazol-3-amine |
|---|---|
| PubChem CID | 57311984 |
| Molecular Formula | C24H29N7OS |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | N-methyl-1-oxo-4-[2-[4-[propyl(pyridin-2-yl)amino]butyl]pyrrol-2-yl]-N-pyridin-4-yl-1,2,5-thiadiazol-3-amine |
| SMILES | CCCN(CCCCC1(C2=NS(=O)N=C2N(C)c2ccncc2)C=CC=N1)c1ccccn1 |
| InChI | InChI=1S/C24H29N7OS/c1-3-18-31(21-9-4-6-14-26-21)19-7-5-12-24(13-8-15-27-24)22-23(29-33(32)28-22)30(2)20-10-16-25-17-11-20/h4,6,8-11,13-17H,3,5,7,12,18-19H2,1-2H3 |
| InChIKey | DRNQEULAKZODIU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 86.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|