C11H19ClN2 — CID 141442378
N,N-dipropylpyridin-4-amine;hydrochloride (PubChem CID 141442378) has the molecular formula C11H19ClN2 and a molecular weight of 214.74 g/mol. Its IUPAC name is N,N-dipropylpyridin-4-amine;hydrochloride.
| Compound Name | N,N-dipropylpyridin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 141442378 |
| Molecular Formula | C11H19ClN2 |
| Molecular Weight | 214.74 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | N,N-dipropylpyridin-4-amine;hydrochloride |
| SMILES | CCCN(CCC)c1ccncc1.Cl |
| InChI | InChI=1S/C11H18N2.ClH/c1-3-9-13(10-4-2)11-5-7-12-8-6-11;/h5-8H,3-4,9-10H2,1-2H3;1H |
| InChIKey | USUYYAJMVHKIGO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.74 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |