C12H22O4 — CID 57314911
ethyl 4,5-dihydroxy-3-methylnon-8-enoate (PubChem CID 57314911) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is ethyl 4,5-dihydroxy-3-methylnon-8-enoate.
| Compound Name | ethyl 4,5-dihydroxy-3-methylnon-8-enoate |
|---|---|
| PubChem CID | 57314911 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | ethyl 4,5-dihydroxy-3-methylnon-8-enoate |
| SMILES | C=CCCC(O)C(O)C(C)CC(=O)OCC |
| InChI | InChI=1S/C12H22O4/c1-4-6-7-10(13)12(15)9(3)8-11(14)16-5-2/h4,9-10,12-13,15H,1,5-8H2,2-3H3 |
| InChIKey | AZBJFZBWWIJHSM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|