C11H20N4O2 — CID 57314949
6-amino-1,3-dimethyl-5-(pentylamino)pyrimidine-2,4-dione (PubChem CID 57314949) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 6-amino-1,3-dimethyl-5-(pentylamino)pyrimidine-2,4-dione.
| Compound Name | 6-amino-1,3-dimethyl-5-(pentylamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57314949 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 6-amino-1,3-dimethyl-5-(pentylamino)pyrimidine-2,4-dione |
| SMILES | CCCCCNc1c(N)n(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C11H20N4O2/c1-4-5-6-7-13-8-9(12)14(2)11(17)15(3)10(8)16/h13H,4-7,12H2,1-3H3 |
| InChIKey | FISYTHDHLDCVPF-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|