C16H23NO5 — CID 57316223
3,3-dimethyl-2-(1-prop-2-enoxycarbonyl-3,6-dihydro-2H-pyridine-4-carbonyl)butanoic acid (PubChem CID 57316223) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is 3,3-dimethyl-2-(1-prop-2-enoxycarbonyl-3,6-dihydro-2H-pyridine-4-carbonyl)butanoic acid.
| Compound Name | 3,3-dimethyl-2-(1-prop-2-enoxycarbonyl-3,6-dihydro-2H-pyridine-4-carbonyl)butanoic acid |
|---|---|
| PubChem CID | 57316223 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 3,3-dimethyl-2-(1-prop-2-enoxycarbonyl-3,6-dihydro-2H-pyridine-4-carbonyl)butanoic acid |
| SMILES | C=CCOC(=O)N1CC=C(C(=O)C(C(=O)O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H23NO5/c1-5-10-22-15(21)17-8-6-11(7-9-17)13(18)12(14(19)20)16(2,3)4/h5-6,12H,1,7-10H2,2-4H3,(H,19,20) |
| InChIKey | QUBIVKPKAVKMGD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|