About 1H-indol-6-yl hydrogen carbonate
1H-indol-6-yl hydrogen carbonate (PubChem CID 57316242) has the molecular formula C9H7NO3
and a molecular weight of 177.16 g/mol. Its IUPAC name is 1H-indol-6-yl hydrogen carbonate.
Molecular Properties
| Compound Name | 1H-indol-6-yl hydrogen carbonate |
| PubChem CID | 57316242 |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 1H-indol-6-yl hydrogen carbonate |
| SMILES | O=C(O)Oc1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C9H7NO3/c11-9(12)13-7-2-1-6-3-4-10-8(6)5-7/h1-5,10H,(H,11,12) |
| InChIKey | OAJWTLYTLZNQGA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 1H-indol-6-yl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indol-6-yl hydrogen carbonate?
The IUPAC name of 1H-indol-6-yl hydrogen carbonate (CID 57316242) is 1H-indol-6-yl hydrogen carbonate.
What is the SMILES notation for 1H-indol-6-yl hydrogen carbonate?
The canonical SMILES for 1H-indol-6-yl hydrogen carbonate is O=C(O)Oc1ccc2cc[nH]c2c1.
What is the InChIKey of 1H-indol-6-yl hydrogen carbonate?
The InChIKey is OAJWTLYTLZNQGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO3/c11-9(12)13-7-2-1-6-3-4-10-8(6)5-7/h1-5,10H,(H,11,12).
What are the key properties of 1H-indol-6-yl hydrogen carbonate?
1H-indol-6-yl hydrogen carbonate has a molecular weight of 177.16 g/mol, XLogP of 2.22, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indol-6-yl hydrogen carbonate is sourced from PubChem (CID 57316242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).