About 1H-indol-6-yl pyridine-2-carboxylate
1H-indol-6-yl pyridine-2-carboxylate (PubChem CID 175845725) has the molecular formula C14H10N2O2
and a molecular weight of 238.25 g/mol. Its IUPAC name is 1H-indol-6-yl pyridine-2-carboxylate.
Molecular Properties
| Compound Name | 1H-indol-6-yl pyridine-2-carboxylate |
| PubChem CID | 175845725 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 1H-indol-6-yl pyridine-2-carboxylate |
| SMILES | O=C(Oc1ccc2cc[nH]c2c1)c1ccccn1 |
| InChI | InChI=1S/C14H10N2O2/c17-14(12-3-1-2-7-15-12)18-11-5-4-10-6-8-16-13(10)9-11/h1-9,16H |
| InChIKey | UYTZRCPOUSLGON-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1H-indol-6-yl pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indol-6-yl pyridine-2-carboxylate?
The IUPAC name of 1H-indol-6-yl pyridine-2-carboxylate (CID 175845725) is 1H-indol-6-yl pyridine-2-carboxylate.
What is the SMILES notation for 1H-indol-6-yl pyridine-2-carboxylate?
The canonical SMILES for 1H-indol-6-yl pyridine-2-carboxylate is O=C(Oc1ccc2cc[nH]c2c1)c1ccccn1.
What is the InChIKey of 1H-indol-6-yl pyridine-2-carboxylate?
The InChIKey is UYTZRCPOUSLGON-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O2/c17-14(12-3-1-2-7-15-12)18-11-5-4-10-6-8-16-13(10)9-11/h1-9,16H.
What are the key properties of 1H-indol-6-yl pyridine-2-carboxylate?
1H-indol-6-yl pyridine-2-carboxylate has a molecular weight of 238.25 g/mol, XLogP of 2.78, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indol-6-yl pyridine-2-carboxylate is sourced from PubChem (CID 175845725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).