C24H46O7 — CID 57316550
1-hydroxyheptan-4-yl 2,3-bis(1-hydroxyheptan-4-yloxy)prop-2-enoate (PubChem CID 57316550) has the molecular formula C24H46O7 and a molecular weight of 446.63 g/mol. Its IUPAC name is 1-hydroxyheptan-4-yl 2,3-bis(1-hydroxyheptan-4-yloxy)prop-2-enoate.
| Compound Name | 1-hydroxyheptan-4-yl 2,3-bis(1-hydroxyheptan-4-yloxy)prop-2-enoate |
|---|---|
| PubChem CID | 57316550 |
| Molecular Formula | C24H46O7 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | 1-hydroxyheptan-4-yl 2,3-bis(1-hydroxyheptan-4-yloxy)prop-2-enoate |
| SMILES | CCCC(CCCO)OC=C(OC(CCC)CCCO)C(=O)OC(CCC)CCCO |
| InChI | InChI=1S/C24H46O7/c1-4-10-20(13-7-16-25)29-19-23(30-21(11-5-2)14-8-17-26)24(28)31-22(12-6-3)15-9-18-27/h19-22,25-27H,4-18H2,1-3H3 |
| InChIKey | IKXVFZUKKNCOAC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|