C16H27NO5 — CID 121267059
1-[[3-(3-hydroxypropoxy)-3-oxoprop-1-enyl]amino]hexan-3-yl 2-methylprop-2-enoate (PubChem CID 121267059) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is 1-[[3-(3-hydroxypropoxy)-3-oxoprop-1-enyl]amino]hexan-3-yl 2-methylprop-2-enoate.
| Compound Name | 1-[[3-(3-hydroxypropoxy)-3-oxoprop-1-enyl]amino]hexan-3-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 121267059 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 1-[[3-(3-hydroxypropoxy)-3-oxoprop-1-enyl]amino]hexan-3-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCC)CCNC=CC(=O)OCCCO |
| InChI | InChI=1S/C16H27NO5/c1-4-6-14(22-16(20)13(2)3)7-9-17-10-8-15(19)21-12-5-11-18/h8,10,14,17-18H,2,4-7,9,11-12H2,1,3H3 |
| InChIKey | XJKQLVAQKQZTAH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|