About (4-undec-10-ynoylphenyl) sulfite
(4-undec-10-ynoylphenyl) sulfite (PubChem CID 57316746) has the molecular formula C17H21O4S-
and a molecular weight of 321.42 g/mol. Its IUPAC name is (4-undec-10-ynoylphenyl) sulfite.
Molecular Properties
| Compound Name | (4-undec-10-ynoylphenyl) sulfite |
| PubChem CID | 57316746 |
| Molecular Formula | C17H21O4S- |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | (4-undec-10-ynoylphenyl) sulfite |
| SMILES | C#CCCCCCCCCC(=O)c1ccc(OS(=O)[O-])cc1 |
| InChI | InChI=1S/C17H22O4S/c1-2-3-4-5-6-7-8-9-10-17(18)15-11-13-16(14-12-15)21-22(19)20/h1,11-14H,3-10H2,(H,19,20)/p-1 |
| InChIKey | JLFZFZAUCPFSPU-UHFFFAOYSA-M |
| XLogP | 3.80 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-undec-10-ynoylphenyl) sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-undec-10-ynoylphenyl) sulfite?
The IUPAC name of (4-undec-10-ynoylphenyl) sulfite (CID 57316746) is (4-undec-10-ynoylphenyl) sulfite.
What is the SMILES notation for (4-undec-10-ynoylphenyl) sulfite?
The canonical SMILES for (4-undec-10-ynoylphenyl) sulfite is C#CCCCCCCCCC(=O)c1ccc(OS(=O)[O-])cc1.
What is the InChIKey of (4-undec-10-ynoylphenyl) sulfite?
The InChIKey is JLFZFZAUCPFSPU-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H22O4S/c1-2-3-4-5-6-7-8-9-10-17(18)15-11-13-16(14-12-15)21-22(19)20/h1,11-14H,3-10H2,(H,19,20)/p-1.
What are the key properties of (4-undec-10-ynoylphenyl) sulfite?
(4-undec-10-ynoylphenyl) sulfite has a molecular weight of 321.42 g/mol, XLogP of 3.80, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-undec-10-ynoylphenyl) sulfite is sourced from PubChem (CID 57316746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).