C15H18BrClO4 — CID 57317036
diethyl 2-[2-(2-bromo-4-chlorophenyl)ethyl]propanedioate (PubChem CID 57317036) has the molecular formula C15H18BrClO4 and a molecular weight of 377.66 g/mol. Its IUPAC name is diethyl 2-[2-(2-bromo-4-chlorophenyl)ethyl]propanedioate.
| Compound Name | diethyl 2-[2-(2-bromo-4-chlorophenyl)ethyl]propanedioate |
|---|---|
| PubChem CID | 57317036 |
| Molecular Formula | C15H18BrClO4 |
| Molecular Weight | 377.66 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | diethyl 2-[2-(2-bromo-4-chlorophenyl)ethyl]propanedioate |
| SMILES | CCOC(=O)C(CCc1ccc(Cl)cc1Br)C(=O)OCC |
| InChI | InChI=1S/C15H18BrClO4/c1-3-20-14(18)12(15(19)21-4-2)8-6-10-5-7-11(17)9-13(10)16/h5,7,9,12H,3-4,6,8H2,1-2H3 |
| InChIKey | GEEGDJDFHDNCRR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.66 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|