C17H31NO2 — CID 57317167
N-[(1S,3R,4S)-4-ethenyl-3-ethyl-1-(hydroxymethyl)-3-pentylcyclopentyl]acetamide (PubChem CID 57317167) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is N-[(1S,3R,4S)-4-ethenyl-3-ethyl-1-(hydroxymethyl)-3-pentylcyclopentyl]acetamide.
| Compound Name | N-[(1S,3R,4S)-4-ethenyl-3-ethyl-1-(hydroxymethyl)-3-pentylcyclopentyl]acetamide |
|---|---|
| PubChem CID | 57317167 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | N-[(1S,3R,4S)-4-ethenyl-3-ethyl-1-(hydroxymethyl)-3-pentylcyclopentyl]acetamide |
| SMILES | C=C[C@@H]1C[C@](CO)(NC(C)=O)C[C@@]1(CC)CCCCC |
| InChI | InChI=1S/C17H31NO2/c1-5-8-9-10-16(7-3)12-17(13-19,18-14(4)20)11-15(16)6-2/h6,15,19H,2,5,7-13H2,1,3-4H3,(H,18,20)/t15-,16-,17+/m1/s1 |
| InChIKey | DVMOSUQLOJNUAQ-ZACQAIPSSA-N |
| XLogP | 3.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|