C13H23F4NO3S — CID 57317252
N-methyl-N-(1,1,2,2-tetrafluoro-3-oxobutyl)octane-1-sulfonamide (PubChem CID 57317252) has the molecular formula C13H23F4NO3S and a molecular weight of 349.39 g/mol. Its IUPAC name is N-methyl-N-(1,1,2,2-tetrafluoro-3-oxobutyl)octane-1-sulfonamide.
| Compound Name | N-methyl-N-(1,1,2,2-tetrafluoro-3-oxobutyl)octane-1-sulfonamide |
|---|---|
| PubChem CID | 57317252 |
| Molecular Formula | C13H23F4NO3S |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | N-methyl-N-(1,1,2,2-tetrafluoro-3-oxobutyl)octane-1-sulfonamide |
| SMILES | CCCCCCCCS(=O)(=O)N(C)C(F)(F)C(F)(F)C(C)=O |
| InChI | InChI=1S/C13H23F4NO3S/c1-4-5-6-7-8-9-10-22(20,21)18(3)13(16,17)12(14,15)11(2)19/h4-10H2,1-3H3 |
| InChIKey | JRCCHNZSLRRONN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|