C15H25F4NO4S — CID 19907538
4,4,5,5-tetrafluoro-2-methylidene-5-[methyl(octylsulfonyl)amino]pentanoic acid (PubChem CID 19907538) has the molecular formula C15H25F4NO4S and a molecular weight of 391.43 g/mol. Its IUPAC name is 4,4,5,5-tetrafluoro-2-methylidene-5-[methyl(octylsulfonyl)amino]pentanoic acid.
| Compound Name | 4,4,5,5-tetrafluoro-2-methylidene-5-[methyl(octylsulfonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 19907538 |
| Molecular Formula | C15H25F4NO4S |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 4,4,5,5-tetrafluoro-2-methylidene-5-[methyl(octylsulfonyl)amino]pentanoic acid |
| SMILES | C=C(CC(F)(F)C(F)(F)N(C)S(=O)(=O)CCCCCCCC)C(=O)O |
| InChI | InChI=1S/C15H25F4NO4S/c1-4-5-6-7-8-9-10-25(23,24)20(3)15(18,19)14(16,17)11-12(2)13(21)22/h2,4-11H2,1,3H3,(H,21,22) |
| InChIKey | OILJQTPGVMPYCP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|