C11H21NO6S — CID 87611333
(2S)-2-methyl-2-[methyl(pentylsulfonyl)amino]butanedioic acid (PubChem CID 87611333) has the molecular formula C11H21NO6S and a molecular weight of 295.36 g/mol. Its IUPAC name is (2S)-2-methyl-2-[methyl(pentylsulfonyl)amino]butanedioic acid.
| Compound Name | (2S)-2-methyl-2-[methyl(pentylsulfonyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 87611333 |
| Molecular Formula | C11H21NO6S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (2S)-2-methyl-2-[methyl(pentylsulfonyl)amino]butanedioic acid |
| SMILES | CCCCCS(=O)(=O)N(C)[C@@](C)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H21NO6S/c1-4-5-6-7-19(17,18)12(3)11(2,10(15)16)8-9(13)14/h4-8H2,1-3H3,(H,13,14)(H,15,16)/t11-/m0/s1 |
| InChIKey | PCSMLTQLQBEGNZ-NSHDSACASA-N |
| XLogP | 0.76 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|