C10H15F4NO4S — CID 87902551
5-(butylsulfonylamino)-4,4,5,5-tetrafluoro-2-methylidenepentanoic acid (PubChem CID 87902551) has the molecular formula C10H15F4NO4S and a molecular weight of 321.29 g/mol. Its IUPAC name is 5-(butylsulfonylamino)-4,4,5,5-tetrafluoro-2-methylidenepentanoic acid.
| Compound Name | 5-(butylsulfonylamino)-4,4,5,5-tetrafluoro-2-methylidenepentanoic acid |
|---|---|
| PubChem CID | 87902551 |
| Molecular Formula | C10H15F4NO4S |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 5-(butylsulfonylamino)-4,4,5,5-tetrafluoro-2-methylidenepentanoic acid |
| SMILES | C=C(CC(F)(F)C(F)(F)NS(=O)(=O)CCCC)C(=O)O |
| InChI | InChI=1S/C10H15F4NO4S/c1-3-4-5-20(18,19)15-10(13,14)9(11,12)6-7(2)8(16)17/h15H,2-6H2,1H3,(H,16,17) |
| InChIKey | IQYQMNFEBIUMMS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|