C26H26FN3O5 — CID 57318414
20-ethyl-7-fluoro-20-[hydroxy(morpholin-4-yl)methyl]-17-oxa-3,13-diazapentacyclo[11.9.0.02,11.04,9.015,21]docosa-1(22),2(11),3,5,7,9,15(21)-heptaene-14,18-dione (PubChem CID 57318414) has the molecular formula C26H26FN3O5 and a molecular weight of 479.51 g/mol. Its IUPAC name is 20-ethyl-7-fluoro-20-[hydroxy(morpholin-4-yl)methyl]-17-oxa-3,13-diazapentacyclo[11.9.0.02,11.04,9.015,21]docosa-1(22),2(11),3,5,7,9,15(21)-heptaene-14,18-dione.
| Compound Name | 20-ethyl-7-fluoro-20-[hydroxy(morpholin-4-yl)methyl]-17-oxa-3,13-diazapentacyclo[11.9.0.02,11.04,9.015,21]docosa-1(22),2(11),3,5,7,9,15(21)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 57318414 |
| Molecular Formula | C26H26FN3O5 |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 20-ethyl-7-fluoro-20-[hydroxy(morpholin-4-yl)methyl]-17-oxa-3,13-diazapentacyclo[11.9.0.02,11.04,9.015,21]docosa-1(22),2(11),3,5,7,9,15(21)-heptaene-14,18-dione |
| SMILES | CCC1(C(O)N2CCOCC2)CC(=O)OCc2c1cc1n(c2=O)Cc2cc3cc(F)ccc3nc2-1 |
| InChI | InChI=1S/C26H26FN3O5/c1-2-26(25(33)29-5-7-34-8-6-29)12-22(31)35-14-18-19(26)11-21-23-16(13-30(21)24(18)32)9-15-10-17(27)3-4-20(15)28-23/h3-4,9-11,25,33H,2,5-8,12-14H2,1H3 |
| InChIKey | RLRAGGUCHKRIKF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|